2-methylbutan-2-yl 3-methylbutanoate


tert-amyl isovalerate; 2-methylbutan-2-yl 3-methylbutanoate
Formula:C10H20O2; 172.27 g/mol
InChiKey:FQTWYBHJKXPHSO-UHFFFAOYSA-N
SMILES:CCC(C)(C)OC(=O)CC(C)C
Molecular structure of 2-methylbutan-2-yl 3-methylbutanoate
Density:0.861 g/mL
Molar volume:200.1 mL/mol
Boiling point:174 °C

Isomers

1-(2-butenyloxy)-2-butoxyethane
Molecular structure of 1-(2-butenyloxy)-2-butoxyethane
1-(2-butenyloxy)-2-(3-methylpropyloxy)ethane
Molecular structure of 1-(2-butenyloxy)-2-(3-methylpropyloxy)ethane
butyl hexanoate
Molecular structure of butyl hexanoate
2-butylhexanoic acid
Molecular structure of 2-butylhexanoic acid
cyclohexanone diethyl ketal
Molecular structure of cyclohexanone diethyl ketal
decanoic acid
Molecular structure of decanoic acid
7,7-dimethyloctanoic acid
Molecular structure of 7,7-dimethyloctanoic acid
cis-1-(1-ethoxyethoxy)-3-hexene
Molecular structure of cis-1-(1-ethoxyethoxy)-3-hexene
ethyl 2,2-diethylbutyrate
Molecular structure of ethyl 2,2-diethylbutyrate
ethyl 2-ethylhexanoate
Molecular structure of ethyl 2-ethylhexanoate
2-ethylhexyl acetate
Molecular structure of 2-ethylhexyl acetate
ethyl octanoate
Molecular structure of ethyl octanoate
4-ethyloctanoic acid
Molecular structure of 4-ethyloctanoic acid
2-(heptan-3-yl)-1,3-dioxolane
Molecular structure of 2-(heptan-3-yl)-1,3-dioxolane
heptyl propanoate
Molecular structure of heptyl propanoate
hexyl butanoate
Molecular structure of hexyl butanoate
hexyl isobutyrate
Molecular structure of hexyl isobutyrate
hydroxycitronellal
Molecular structure of hydroxycitronellal
6-hydroxydecan-5-one
Molecular structure of 6-hydroxydecan-5-one
3-hydroxy-5,5-diisopropyltetrahydrofuran
Molecular structure of 3-hydroxy-5,5-diisopropyltetrahydrofuran
3-hydroxy-2,2-dimethyl-5,5-diethyltetrahydrofuran
Molecular structure of 3-hydroxy-2,2-dimethyl-5,5-diethyltetrahydrofuran
3-hydroxy-5,5-dipropyltetrahydrofuran
Molecular structure of 3-hydroxy-5,5-dipropyltetrahydrofuran
2-methylbutan-2-yl 3-methylbutanoate
Molecular structure of 2-methylbutan-2-yl 3-methylbutanoate
2-methylbutyl 3-methylbutanoate
Molecular structure of 2-methylbutyl 3-methylbutanoate
3-methylbutyl 2-methylbutanoate
Molecular structure of 3-methylbutyl 2-methylbutanoate
3-methylbutyl 3-methylbutanoate
Molecular structure of 3-methylbutyl 3-methylbutanoate
3-methylbutyl pentanoate
Molecular structure of 3-methylbutyl pentanoate
methyl nonanoate
Molecular structure of methyl nonanoate
4-methylnonanoic acid
Molecular structure of 4-methylnonanoic acid
4-methylpentan-2-yl butanoate
Molecular structure of 4-methylpentan-2-yl butanoate
octyl acetate
Molecular structure of octyl acetate
2-octyl acetate
Molecular structure of 2-octyl acetate
3-octyl acetate
Molecular structure of 3-octyl acetate
pentyl pentanoate
Molecular structure of pentyl pentanoate
propyl heptanoate
Molecular structure of propyl heptanoate
2-propylheptanoic acid
Molecular structure of 2-propylheptanoic acid
cis-terpin hydrate
Molecular structure of cis-terpin hydrate